2-Pyridinamine-d4 is a deuterated form of 2-aminopyridine where all four hydrogen atoms on the pyridine ring are replaced with deuterium. It is primarily used as an internal standard or labeled reagent in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 87802-54-8
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Methyl 2-((5-amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate
Research compound
2-Aminopyridine-d6 naphthol
deuterated research compound
2-AMINOPYRIDINE
pharmaceutical intermediate for antihistamines and other drugs
3,4,5,6-tetradeuteriopyridin-2-amine
ICSNLGPSRYBMBD-RHQRLBAQSA-N
[2H]C1=C(C(=NC(=C1[2H])N)[2H])[2H]