This compound is a research compound with an aromatic and polar structure, containing amine, ether, and hydroxyl functional groups. It is supplied as a laboratory reagent for chemical and pharmaceutical research.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 861841-90-9
(S)-(+)-4-Phenyl-2-oxazolidinone
chiral auxiliary for asymmetric synthesis
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
research compound
Cyclo(RGDfC)
research reagent
(3-Morpholinophenyl)boronic acid hydrochloride
research compound
1-(3-amino-2-hydroxy-5-phenylmethoxyphenyl)ethanone
VHNDAASEYRABBJ-UHFFFAOYSA-N
CC(=O)C1=C(C(=CC(=C1)OCC2=CC=CC=C2)N)O