4-Chlorobenzoic Acid-d4 is a deuterium-labeled analytical reference standard, specifically the tetradeuterated form of 4-chlorobenzoic acid where all four aromatic hydrogen atoms are replaced with deuterium. It is primarily used as a stable isotope internal standard in quantitative analysis, enabling accurate measurement of the non-deuterated compound in complex matrices.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 85577-25-9
2-NITROBENZOIC-D4 ACID
Deuterated analytical standard
6-bromo-2(1h)-pyridinethione
research compound
6-Bromopyridine-2-sulfonamide
Research reagent
2-Nitroso-2-azaspiro[4,5]decan-3-one
nitrosamine impurity reference standard
4-Chlorobenzoic acid
Intermediate for dyes, fungicides, and pharmaceuticals
4-chloro-2,3,5,6-tetradeuteriobenzoic acid
XRHGYUZYPHTUJZ-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])Cl)[2H]