Hydroxy-alpha-sanshool is a fatty amide found in Sichuan pepper species, such as Zanthoxylum schinifolium, Zanthoxylum bungeanum, and Zanthoxylum piperitum. It is the compound primarily responsible for the characteristic pungent and tingling flavor associated with these peppers.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 83883-10-7
3-Hexanone, 5-mercapto-5-methyl-
Flavor and fragrance ingredient
Methyl 5-allyl-3-methoxysalicylate
flavor and fragrance ingredient
2,4,6-TRICHLOROANISOLE
off-flavor agent in wine corks
BETA-CARYOPHYLLENE
Fragrance and flavoring agent
(2E,6Z,8E,10E)-N-(2-hydroxy-2-methylpropyl)dodeca-2,6,8,10-tetraenamide
LHFKHAVGGJJQFF-UEOYEZOQSA-N
C/C=C/C=C/C=C\CC/C=C/C(=O)NCC(C)(C)O