This compound is a deuterated form of malonic acid, specifically labeled with deuterium at both the methylene and carboxyl positions. It is primarily used as a research reagent in chemical and biochemical studies, particularly for tracing reaction mechanisms and metabolic pathways due to the presence of deuterium atoms.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 813-56-9
TRIBUTYLPHOSPHINE OXIDE
research compound
Pp60v-src Autophosphorylation Site, Tyrosine Kinase Substrate
tyrosine kinase substrate research reagent
Diethyl 2,3-difluoromaleate
research compound
17ALPHA-ESTRADIOL-2,4-D2
deuterated reference standard
Malonic acid
Pharmaceutical intermediate for barbiturates and vitamins
Malonic acid, disodium salt
Buffering agent and chemical intermediate
dideuterio 2,2-dideuteriopropanedioate
OFOBLEOULBTSOW-BGOGGDMHSA-N
[2H]C([2H])(C(=O)O[2H])C(=O)O[2H]