Dehydrocholic acid is a steroidal bile acid derivative used as a pharmaceutical raw material. Its structure features multiple ketone groups and a carboxylic acid moiety, contributing to its role in pharmaceutical manufacturing.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 81-23-2
Glycodehydrocholic acid
bile acid glycine conjugate
Cholic acid
active pharmaceutical ingredient
Warfarin
anticoagulant active pharmaceutical ingredient
Ethylbisiminomethylguaiacol manganese chloride
Active pharmaceutical ingredient
Pravastatin
active pharmaceutical ingredient
Sodium dehydrocholate
bile acid
Taurodehydrocholate
bile acid research reagent
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
OHXPGWPVLFPUSM-KLRNGDHRSA-N
C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C