1-Aminonaphthalene-d9 is a deuterated research reagent where all hydrogen atoms in the naphthalene ring and the amino group are replaced by deuterium. It is primarily used as a stable isotope-labeled compound for analytical and research applications, particularly in mass spectrometry and metabolic studies.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 78832-56-1
2-NAPHTHOL-D8
Deuterated naphthol reference standard
(3-acetamidophenyl)boronic acid
research compound for organic synthesis
2-NITROPYRENE
research compound
Oxalyl chloride
chlorinating reagent in organic synthesis
1-нафтиламин
intermediate for dyes and antioxidants
1-Aminonaphthalene-d7
deuterated research standard
N,N,2,3,4,5,6,7,8-nonadeuterionaphthalen-1-amine
RUFPHBVGCFYCNW-CPTGGYHJSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2N([2H])[2H])[2H])[2H])[2H])[2H])[2H]