Meta-topolin is a synthetic cytokinin compound used primarily as a research reagent in plant tissue culture studies. It is investigated for its role in regulating plant growth and development, particularly in mitigating hyperhydricity and improving regeneration efficiency.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 75737-38-1
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
2,3-Difluorobenzyl alcohol
research compound
6-Benzylaminopurine
plant growth regulator
3-[(7H-purin-6-ylamino)methyl]phenol
BUDWTFCZGZYQHZ-UHFFFAOYSA-N
C1=CC(=CC(=C1)O)CNC2=NC=NC3=C2NC=N3