This compound is a fully deuterated form of pyridine, where all five hydrogen atoms on the aromatic ring are replaced by deuterium. It is primarily used as a stable isotope-labeled intermediate in pharmaceutical research and manufacturing, enabling tracing and mechanistic studies.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 7291-22-7
2-amino-2-(3-chlorophenyl)acetic acid
pharmaceutical intermediate
(3R)-1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
pharmaceutical intermediate for synthesis
4,6-dichloronicotinic acid
Pharmaceutical intermediate for synthesis
2-Fluoro-5-nitrobenzoic acid
Pharmaceutical intermediate for synthesis
Azabenzene
solvent and intermediate for pharmaceuticals
Dibromobis(pyridine)nickel
Research reagent for coordination chemistry
Dichloronickel;pyridine
research compound
Dibromotetrakis(pyridine)nickel
coordination chemistry research reagent
2,3,4,5,6-pentadeuteriopyridine
JUJWROOIHBZHMG-RALIUCGRSA-N
[2H]C1=C(C(=NC(=C1[2H])[2H])[2H])[2H]