1-Carbobenzoxy-2-piperidinecarboxylic acid is a protected piperidine derivative used primarily as a building block in peptide synthesis. Its structure features a carbobenzoxy (Cbz) protecting group attached to the nitrogen atom of the piperidine ring, with a carboxylic acid functional group available for further coupling reactions.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 71170-88-2
Carbobenzoxyproline
Protected amino acid intermediate
N-(Carbobenzyloxy)-DL-proline
research compound
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid
Peptide research compound
1-(1,1-Dimethylethyl) (2S,4S)-4-phenyl-1,2-pyrrolidinedicarboxylate
pharmaceutical intermediate for peptide synthesis
O-tert-Butyl-L-tyrosine
pharmaceutical intermediate for peptide synthesis
Benzyl (2S)-2-amino-4-methylpentanoate hydrochloride
pharmaceutical intermediate for peptide synthesis
1-tert-Butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate
Pharmaceutical intermediate for synthesis
1-phenylmethoxycarbonylpiperidine-2-carboxylic acid
ZSAIHAKADPJIGN-UHFFFAOYSA-N
C1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2