Dideoxy GTP is a dideoxynucleotide triphosphate used as a chain-terminating inhibitor in the Sanger method of DNA sequencing. It lacks hydroxyl groups at the 2' and 3' positions of the ribose sugar, preventing further DNA strand elongation by DNA polymerase.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 68726-28-3
3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate)
Nucleotide analogue research reagent
DdATP
DNA sequencing reagent
Boc-2-aminobenzoic acid
research compound
5-Bromo-4,6-dichloropyrimidine
Research chemical intermediate
Ethylenediaminetriacetic acid
chelating agent
4-Methoxy-3-methylbenzoic Acid
research compound
[[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
HDRRAMINWIWTNU-PRJDIBJQSA-N
C1CC(O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O