3,5-Dichlorophenylboronic acid is a boronic acid reagent used in organic synthesis. Its structure features an aromatic ring with two chlorine substituents and a boronic acid group, making it useful for carbon-carbon bond formation reactions such as Suzuki coupling.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 67492-50-6
2-Butoxyphenylboronic acid
boronic acid reagent for synthesis
5-Bromo-2-methoxypyridine-4-boronic acid
boronic acid reagent for synthesis
3-(Methoxycarbonyl)benzeneboronic Acid
boronic acid reagent for synthesis
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
METHYLMAGNESIUM CHLORIDE
Grignard reagent for organic synthesis
4-Azidopuromycin
research compound
N-Acetyl-D-mannosamine hydrate
Biochemical research reagent
(4,4'-Di-tert-butyl-2,2'-bipyridine)bis[(2-pyridinyl)phenyl]iridium(III) Hexafluorophosphate
phosphorescent organic light-emitting diode material
(3,5-dichlorophenyl)boronic acid
DKYRKAIKWFHQHM-UHFFFAOYSA-N
B(C1=CC(=CC(=C1)Cl)Cl)(O)O