This compound is a chiral carboxylic acid that serves as a key building block in the synthesis of certain pyrethroid insecticides. Its structure features a cyclopropane ring with dichloroethenyl and carboxylic acid substituents, characteristic of a common synthetic intermediate.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 55701-03-6
(1R-trans)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
pyrethroid insecticide intermediate
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Pyrethroid insecticide intermediate
Methyl 2,4-dichlorobenzeneacetate
agrochemical intermediate
Methyl 3-(4-hydroxyphenyl)propionate
nitrification inhibitor and plant growth regulator
Parathion
Insecticide and acaricide
Ethion
Organophosphate insecticide and acaricide
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
certified reference standard
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
Pyrethroid insecticide intermediate
cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid
LLMLSUSAKZVFOA-XINAWCOVSA-N
CC1([C@@H]([C@H]1C(=O)O)C=C(Cl)Cl)C