Alverine citrate is a salt form of alverine, a compound used as a pharmaceutical raw material. It functions as a smooth muscle relaxant, affecting involuntary muscles in the gastrointestinal tract.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 5560-59-8
N-Phenylpropyl Alverine Hydrochloride
smooth muscle relaxant drug
3-Phenyl-N,N-bis(3-phenylpropyl)propan-1-amine
research compound
Tandetoron
pharmaceutical active ingredient
Nimustine hydrochloride
active pharmaceutical ingredient
Lumbokinase capsules
active pharmaceutical ingredient
Cephalonium
veterinary cephalosporin antibiotic
Alverine Impurity 19
nitrosamine reference standard
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid
RYHCACJBKCOBTJ-UHFFFAOYSA-N
CCN(CCCC1=CC=CC=C1)CCCC2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O