L-Phenylalanine-2-d1 is a deuterium-labeled derivative of the amino acid L-phenylalanine, where one hydrogen atom at the 2-position is replaced by deuterium. It is primarily used as an isotopically labeled research compound in analytical chemistry and metabolic studies.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 54793-54-3
4-Aminophenol-d4
isotopically labeled research compound
2,4'-Dibromoacetophenone-2-13C
isotopically labeled research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
5-bromo-4-methylthiophene-2-carboxylic acid
research compound
5-Iodo-2-methylbenzoic acid
Research reagent
3,3',5,5'-TETRAMETHYLBENZIDINE
clinical reagent for testing blood
6-Bromo-1-methoxynaphthalene
research compound
L-Phenyl-d5-alanine
Deuterated research compound
(2S)-2-amino-2-deuterio-3-phenylpropanoic acid
COLNVLDHVKWLRT-ZXEPEWCSSA-N
[2H][C@](CC1=CC=CC=C1)(C(=O)O)N