This compound is a protected amino acid intermediate, specifically the benzyl ester of O4-benzyl-L-tyrosine. It features a core tyrosine structure with both amino and carboxyl groups protected, making it suitable for use in peptide synthesis and pharmaceutical manufacturing.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 52799-86-7
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
H-Phe-OBzl.TosOH
protected phenylalanine derivative for peptide synthesis
L-Phenylalanine benzyl ester hydrochloride
Peptide synthesis intermediate
O-Benzyl-L-tyrosine
Pharmaceutical intermediate for peptide synthesis
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
N-(Diphenylmethylene)glycine tert-butyl ester
protected amino acid intermediate
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate
protected amino acid intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate
UCRXQUVKDMVBBM-QFIPXVFZSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)OCC3=CC=CC=C3)N