(2H10)Cyclohexanone is a fully deuterated analog of cyclohexanone, used as an analytical standard in research. Its isotopic labeling makes it valuable for mass spectrometry and nuclear magnetic resonance studies, particularly in structural chemistry investigations.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 51209-49-5
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Pentanedioic-d6 acid
deuterated analytical standard
1,2,3,4,5-pentadeuterio-6-methylbenzene
deuterated analytical standard
Tris(di(2H3)methylamido)phosphorus
Deuterated research compound
4-Biphenylboronic acid
research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-one
JHIVVAPYMSGYDF-YXALHFAPSA-N
[2H]C1(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]