Mandyphos SL-M004-1 is a chiral ligand used in asymmetric catalysis, primarily employed as a research reagent. Its structure, derived from evidence, indicates a salt-like, multi-fragment organometallic compound containing iron, with features such as amine and ether functional groups and aromatic rings.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 494227-37-1
(S)-(+)-N,N-Dimethyl-1-((R)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
(R)-(-)-N,N-Dimethyl-1-((S)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(bis(4-methoxy-3,5-bis(2-methyl-2-propanyl)phenyl)phosphine)
chiral ligand for asymmetric catalysis
(1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene
chiral ligand for asymmetric catalysis
(D-Lys16)-ACTH (1-24) (human, bovine, rat) trifluoroacetate salt
research reagent for receptor studies
2-fluoropyrazine
research compound
N-Hydroxybenzamide
analytical reagent and research compound
Indoline
research compound
HEJIDMKBSDYNOY-UHFFFAOYSA-N
CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.[Fe]