2,5-Thiophenedicarboxylic acid is a chemical compound featuring a thiophene ring with two carboxylic acid groups. It serves as a building block for organic synthesis, particularly in the production of various organic compounds and materials.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 4282-31-9
5-acetylthiophene-2-carboxylic acid
Pharmaceutical intermediate for synthesis
4-Butylbenzoic acid
Building block for organic synthesis
9,9-Dimethyl-9H-fluorene
Building block for organic synthesis
4-bromo-3'-chloro-1,1'-biphenyl
Building block for organic synthesis
4-Bromodibenzothiophene
Building block for organic synthesis
2,5-dimethyl furan-2,5-dicarboxylate
Building block for polymer synthesis
Фторид тетрабутиламмония
Phase-transfer catalyst and organic synthesis reagent
Tripropylene glycol diacrylate
UV-curable coatings and inks monomer
thiophene-2,5-dicarboxylic acid
YCGAZNXXGKTASZ-UHFFFAOYSA-N
C1=C(SC(=C1)C(=O)O)C(=O)O