1,2-Dihydro Dexamethasone is a steroidal compound that serves as an active pharmaceutical ingredient. Its structure features a fused four-ring steroid framework with multiple hydroxyl groups and a fluorine atom, contributing to its chemical properties.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 426-17-5
Alpha-Cyclopentylmandelic acid
Glycopyrrolate related compound C reference standard
Ципротерона ацетат
active pharmaceutical ingredient
Flumequine
fluoroquinolone antibiotic
Bevantolol hydrochloride
active pharmaceutical ingredient
FLUDROCORTISONE ACETATE
active pharmaceutical ingredient
Fluorogestone acetate
progestational hormone
(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
YYZXYYHUGHQGHI-CXSFZGCWSA-N
C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C