8-Aminoadenosine is a purine nucleoside analog featuring an amino group substitution at the 8-position of the adenine base. It is primarily used as a research reagent for studying adenosine receptor interactions and nucleotide metabolism.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 3868-33-5
8-Bromoadenosine
research compound
4-Fluoroindole
organic synthesis building block
7-fluoro-1H-indole
Reagent for chemical synthesis
Lithium Tri-sec-butylborohydride
Mild reducing agent in organic synthesis
4-methoxybenzylmagnesium chloride
Grignard reagent for organic synthesis
(2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DVGWFQILDUEEGX-UUOKFMHZSA-N
C1=NC(=C2C(=N1)N(C(=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N