1-Chloroadamantane-d15 is a deuterated research compound where all hydrogen atoms in the adamantane structure are replaced with deuterium. It is primarily used as a labeled reagent in analytical and pharmaceutical research.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 352431-55-1
3-(2-Bromo-4,5-dimethoxyphenyl)propanenitrile
research compound
(2-Mercaptophenyl)boronic acid
research compound
3-Chloro-2-fluorophenylboronic acid
Research reagent for organic synthesis
1-tert-butoxycarbonylaminocyclopentanecarboxylic acid
Building block for peptide synthesis
1-Chloroadamantane
pharmaceutical intermediate for amantadine synthesis
1-chloro-2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane
OZNXTQSXSHODFR-BXSQCBKHSA-N
[2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])Cl)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H]