1,2-Difluoro-4-(trifluoromethyl)benzene is a fluorinated aromatic compound used primarily as an industrial chemical intermediate. Its structure features a benzene ring substituted with two fluorine atoms and a trifluoromethyl group, contributing to its hydrophobic and stable properties.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 32137-19-2
Magnesium 2-methylpropan-2-olate
Base in organic synthesis
Cyclohexane, 1-isocyanato-4-methyl-, trans-
aliphatic isocyanate monomer
(3,4-Dichlorophenyl)acetonitrile
chemical intermediate
N-Phenyl-[1,1'-biphenyl]-4-amine
industrial chemical intermediate
1,2-difluoro-4-(trifluoromethyl)benzene
MVCGQTYWLZSKSB-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)F)F