5-Isoquinolinesulfonic acid is an organic compound featuring a sulfonic acid group attached to an isoquinoline ring. Its primary significance lies in its role as a sulfonic acid intermediate used in industrial chemical synthesis.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 27655-40-9
Butane-1,4-disulfonic acid
Industrial sulfonic acid reagent
Tris(3,5-di-tert-butyl-4-hydroxybenzyl) isocyanurate
Antioxidant for polymer stabilization
Vinyltrimethoxysilane
Silane coupling agent and surface modifier
5-Methoxy-1H-benzotriazole
Chemical intermediate for synthesis
Isoquinoline-5-sulfonyl chloride hydrochloride
Pharmaceutical intermediate synthesis
Dimethisoquin hydrochloride
local anesthetic active pharmaceutical ingredient
Isoquinoline-4-boronic acid
research compound for organic synthesis
6-Aminoisoquinoline
Pharmaceutical intermediate
isoquinoline-5-sulfonic acid
YFMJTLUPSMCTOQ-UHFFFAOYSA-N
C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)O