3-(Trimethoxysilyl)propyl methacrylate is a silane coupling agent commonly used to improve adhesion between organic polymers and inorganic substrates. Its molecular structure combines a methacrylate group for polymer bonding with trimethoxysilyl groups for surface attachment, making it valuable in adhesive formulations.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 2530-85-0
3-Chloropropyltrimethoxysilane
Coupling agent for filled composites
Sodium O-isobutyl dithiocarbonate
flotation collector agent
Benzyltributylammonium bromide
Phase transfer catalyst
Полиэтиленгликоль
polymer and surfactant raw material
3-trimethoxysilylpropyl 2-methylprop-2-enoate
XDLMVUHYZWKMMD-UHFFFAOYSA-N
CC(=C)C(=O)OCCC[Si](OC)(OC)OC