2-Chloro-4-iodo-6-(trifluoromethyl)pyridine is a halogenated pyridine derivative used as a research compound. Its structure features a pyridine ring substituted with chlorine, iodine, and a trifluoromethyl group, giving it distinctive chemical properties for laboratory investigations.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 205444-22-0
3,3',5,5'-Tetraiodothyroformic acid
research compound for thyroid hormone studies
4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
Chain transfer agent for RAFT polymerization
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid
PEG-linked maleimide reagent for conjugation
(3-(difluoromethoxy)-5-fluorophenyl)boronic acid
research reagent for chemical synthesis
2-chloro-4-iodo-6-(trifluoromethyl)pyridine
JHKQSKCFLAXPKK-UHFFFAOYSA-N
C1=C(C=C(N=C1C(F)(F)F)Cl)I