Methyl 2,6-difluoro-4-hydroxybenzoate is a fluorinated aromatic ester used primarily as a research compound in chemical synthesis. Its structure features a difluorinated benzene ring with both ester and hydroxyl functional groups.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 194938-88-0
4-Iodo-2-(trifluoromethyl)benzonitrile
research compound for chemical synthesis
(6-bromo-2-pyridyl)-pentafluoro-sulfane
research compound for chemical synthesis
1-Aminohydantoin hydrochloride
research compound for chemical synthesis
2-chloro-4,6-diphenylpyrimidine
research compound for chemical synthesis
4-Methoxyphenylhydrazine hydrochloride
Chemical research reagent
Methyl 4-(7-(6-cyano-5-(trifluoromethyl)pyridin-3-yl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]octan-5-yl)-2-fluorobenzoate
research compound
2-Tolylboronic acid pinacol ester
Boronic acid ester for Suzuki coupling
4-Chlorochrysene
Research compound for chemical studies
methyl 2,6-difluoro-4-hydroxybenzoate
ZPVGRBTXDTZVIG-UHFFFAOYSA-N
COC(=O)C1=C(C=C(C=C1F)O)F
—