This compound is a research reagent with a complex molecular structure featuring an aromatic ring, amide, and ester groups. Its high flexibility and lipophilicity make it suitable for laboratory studies involving conformationally mobile molecules.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 162358-08-9
4,4'-(Cyclopenta-2,4-dien-1-ylidenemethylene)bis(methylbenzene)
Research compound for organometallic chemistry
5-Bromo-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
boronic acid cross-coupling reagent
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
B-1-dibenzofuranylBoronic acid
Boronic acid for chemical synthesis
diethyl 2-acetamido-2-[2-(4-octylphenyl)ethyl]propanedioate
RYOKCHIAMHPMLV-UHFFFAOYSA-N
CCCCCCCCC1=CC=C(C=C1)CCC(C(=O)OCC)(C(=O)OCC)NC(=O)C