4-Hydroxybenzoic-2,3,5,6-d4 acid is a deuterated form of 4-hydroxybenzoic acid where all four aromatic hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry to improve the accuracy of quantitative measurements.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 152404-47-2
Acenaphthylene D8
deuterated internal standard for analytical chemistry
Triruthenium dodecacarbonyl
organometallic research reagent
5-Bromo-6-methoxy-1H-indazole
research compound
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
5-bromo-2-methoxy-3-nitropyridine
research compound
Potassium 4-hydroxybenzoate
preservative in cosmetics and food
Пара-Гидроксибензойная кислота
intermediate for food preservatives
2,3,5,6-tetradeuterio-4-hydroxybenzoic acid
FJKROLUGYXJWQN-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])O)[2H]