Mal-PEG4-PFP ester is a heterobifunctional crosslinking reagent featuring a maleimide group and a pentafluorophenyl ester linked by a hydrophilic polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation chemistry for the modification of biomolecules.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1415800-42-8
Mal-PEG2-PFP ester
heterobifunctional crosslinking reagent
T-Boc-N-amido-PEG12-acid
PEG-based linker for bioconjugation
4,6-DICHLORO-2-METHYLPYRIMIDINE-5-CARBALDEHYDE
research compound
Ethyl (2S,5R)-5-((benzyloxy)amino)piperidine-2-carboxylate
Research compound
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate
XGSVXFAIAZKWST-UHFFFAOYSA-N
C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F