(3-Phenoxyphenyl)methanol is a chemical compound primarily known as a metabolite formed during the hydrolysis of certain pyrethroid insecticides, such as permethrin, by enzymes like pyrethroid hydrolase. It features an alcohol group, two aromatic rings, and an ether linkage, contributing to its moderate lipophilicity and polar surface area.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 13826-35-2
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
Имидаклоприд
systemic insecticide for crop protection
1-[(difluoromethyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-7-fluoro-1H-indol-2-ol
Agrochemical intermediate or active ingredient
2,4-DICHLOROTOLUENE-3,5,6-D3
Deuterated agrochemical reference standard
Quizalofop-ethyl D3 (3,3,3-D3)
Herbicide active ingredient
(3-phenoxyphenyl)methanol
KGANAERDZBAECK-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=CC=CC(=C2)CO