This compound is a ruthenium-based asymmetric hydrogenation catalyst, commonly used in research and development for the synthesis of enantiomerically enriched compounds. It features a chiral diphosphine ligand coordinated to ruthenium, enabling high selectivity in reduction reactions.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 130004-33-0
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
chiral ruthenium catalyst for asymmetric synthesis
[Rh COD (R)-Binap]BF4
homogeneous hydrogenation catalyst
(S)-(-)-binap-chloro-(benzol)ruthenium-chloride
asymmetric catalysis reagent
[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride
asymmetric catalysis research reagent
2-Chloro-4,6-bis(phenyl-d5)-1,3,5-triazine
Deuterated research standard
(1,10-Phenanthroline)(trifluoromethyl)copper(I)
research reagent for cross-coupling reactions
L-Methionine-d3
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
dichlororuthenium;[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane;1-methyl-4-propan-2-ylbenzene
WNHLGYRPKARUHY-UHFFFAOYSA-L
CC1=CC=C(C=C1)C(C)C.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8.Cl[Ru]Cl