1,3-Diethylbenzene-d14 is a fully deuterated form of 1,3-diethylbenzene, used primarily as a reference standard in analytical chemistry. Its isotopic labeling provides distinct mass spectrometric characteristics, making it valuable for quantification and calibration in gas chromatography and mass spectrometry applications.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1219803-40-3
Caproic acid-6,6,6-d3
deuterated reference standard for analytical chemistry
4-Aminopiperidine-3,3,4,5,5-d5
deuterated research compound
2,5-dichlorophenol-3,4,6-d3
deuterated research reference standard
1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one
Deuterated internal standard for analysis
Cetirizine D4
Deuterated research reference standard
1,2,3,5-tetradeuterio-4,6-bis(1,1,2,2,2-pentadeuterioethyl)benzene
AFZZYIJIWUTJFO-NFUPRKAOSA-N
[2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[2H]