2,4'-Dichlorobiphenyl-d8 is a deuterated analytical reference standard, specifically a polychlorinated biphenyl (PCB) congener where all hydrogen atoms on the biphenyl rings are replaced with deuterium. It is primarily used as an internal standard or labeled surrogate in mass spectrometry and analytical chemistry for the quantification and tracing of PCB compounds in environmental and research samples.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1219795-19-3
2-Methoxynaphthalene-1,3,4,5,6,7,8-d7
research reagent
2-Chlorobenzoic Acid-d4
deuterated analytical reference standard
2,4,6-TRIBROMOPHENOL-3,5-D2
deuterated research compound
2-nitrobenzonitrile-d4
deuterated internal standard
2,4'-DICHLOROBIPHENYL
industrial chemical intermediate
1-chloro-2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-3,4,5,6-tetradeuteriobenzene
UFNIBRDIUNVOMX-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1[2H])C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])Cl)[2H])[2H]