This compound is a chemical compound used primarily as a research reagent. Its structure features a benzodioxole ring with two fluorine atoms, an aromatic ring, and hydroxyl and ether functional groups, giving it moderate polarity and low molecular weight.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1211539-82-0
Diacetic Aceclofenac
Impurity reference standard
3-CHLOROTOLUENE-D7
Deuterated analytical reference standard
P-21 nootropic peptide
nootropic peptide research compound
Epicatechin gallate
polyphenol with enzyme inhibition activity
2,2-difluoro-1,3-benzodioxol-5-ol
GEHVTOIGEVNIEQ-UHFFFAOYSA-N
C1=CC2=C(C=C1O)OC(O2)(F)F