Hexaphenoxycyclotriphosphazene is an industrial chemical used primarily as a flame retardant additive. It is incorporated into materials such as plastics, textiles, and surface coatings to inhibit or slow the spread of fire through various physical and chemical mechanisms.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1184-10-7
Melamine pyrophosphate
Flame retardant additive
1,2,5,6-Tetrabromocyclooctane
Flame retardant additive
Melamine phosphate
Flame retardant additive
Tris(2,3-dibromopropyl) isocyanurate
Flame retardant additive
Pivalic acid, sodium salt
chemical intermediate for organic synthesis
Methyltrimethoxysilane
Coupling agent and cross-linker
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate
catalyst reagent for chemical synthesis
Tetraethylurea
Industrial chemical intermediate
2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene
RNFJDJUURJAICM-UHFFFAOYSA-N
C1=CC=C(C=C1)OP2(=NP(=NP(=N2)(OC3=CC=CC=C3)OC4=CC=CC=C4)(OC5=CC=CC=C5)OC6=CC=CC=C6)OC7=CC=CC=C7