7-bromo-1H-indole-3-carbaldehyde is a brominated indole derivative used as a research compound. Its structure features an indole core with a formyl group at the 3-position and a bromine atom at the 7-position, contributing to its utility in synthetic chemistry and biological studies.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 115666-21-2
Pseudouridine 5'-phosphate
research compound for RNA modification studies
1-Amino-3-phenylnaphthalene
Research compound
1,3-Bis(2,6-di(pentan-3-yl)phenyl)-1H-imidazol-3-ium chloride
research compound for organic synthesis
4-FLUORO-3-NITROPYRIDINE
Organic synthesis intermediate
7-bromo-1H-indole-3-carbaldehyde
MGPMWCBAOQWENZ-UHFFFAOYSA-N
C1=CC2=C(C(=C1)Br)NC=C2C=O