(2H8)Naphthalene is a deuterium-labeled form of naphthalene where all eight hydrogen atoms are replaced by deuterium. It is primarily used as an isotopically labeled reference standard in analytical chemistry and research applications.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1146-65-2
2,6-Di-iso-propylphenol-d18
isotopically labeled reference standard
4-Acetaminophen-d3 Sulfate Potassium Salt
isotopically labeled reference standard
L-Phenyl-d5-alanine-2,3,3-d3
isotopically labeled reference standard
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
MMT-Hexylaminolinker Phosphoramidite
oligonucleotide synthesis phosphoramidite reagent
(S)-2-(3-Bromophenyl)propanoic acid
Pharmaceutical intermediate or research compound
3-bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine
research compound
Adenosine 5'-diphosphate dipotassium salt
Nucleoside Diphosphate Series
1,2,3,4,5,6,7,8-octadeuterionaphthalene
UFWIBTONFRDIAS-PGRXLJNUSA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H]