3,5-Diiodo-L-thyronine is a chemical compound used as a pharmaceutical intermediate in the synthesis of thyroid hormones. It is structurally related to triiodothyronine (T3), a naturally occurring thyroid hormone that influences metabolism, growth, and development.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 1041-01-6
Левотироксин натрия
active pharmaceutical ingredient
Tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate hemioxalate
Pharmaceutical intermediate
[(4-Chlorobenzoyl)oxy]acetic acid
pharmaceutical intermediate for acemetacin
GCLE
Cephalosporin intermediate for antibiotic synthesis
DODMA
Lipid nanoparticle component for drug delivery
(2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid
ZHSOTLOTTDYIIK-ZDUSSCGKSA-N
C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@@H](C(=O)O)N)I