2-Benzamido-4-mercaptobutanoic acid is a research compound featuring a benzamide group linked to a thiol-containing butanoic acid backbone. Its structure includes an amide, a carboxylic acid, and a thiol group, making it useful as a building block in peptide and intermediate synthesis.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 103796-22-1
1-Nitrosopiperidin-4-yl)diphenylmethanol
Nitrosamine impurity reference standard
4,4'-Diaminooctafluorobiphenyl
research compound for structural studies
4,4'-Dibromooctafluorobiphenyl
Research compound for crystallography studies
3-(3,4-dichlorophenyl)pentanedioic acid
research compound
2-benzamido-4-sulfanylbutanoic acid
ZQQSNOCMNFNYHN-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)NC(CCS)C(=O)O