Fructosylvaline is a small-molecule research compound belonging to the class of fructosamines, formed through the non-enzymatic glycation of the amino acid valine with fructose. It is primarily used as a standard or reference material in studies investigating the Maillard reaction and advanced glycation end-products (AGEs) in food chemistry and biomedical research.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 10003-64-2
3-Fluoro-2-nitrobenzoic acid
research compound
3,5-dibromo-2-fluoro-4-methylpyridine
research compound
3-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Research reagent
1,4-Piperazinediethanesulfonic acid sesquisodium salt
buffering agent in biochemistry
(2S)-3-methyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid
JEQHVKBNRPNQDY-UTINFBMNSA-N
CC(C)[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O