This compound is a chiral phosphine ligand used in asymmetric catalysis. It features a binaphthyl backbone with multiple aromatic rings and zero polar surface area, reflecting its nonpolar character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl
chiral phosphine ligand for catalysis
[RUCL(P-CYMENE)((R)-TOLBINAP)]CL
asymmetric hydrogenation catalyst
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
(S)-Ru(OAc)2(T-BINAP)
asymmetric hydrogenation catalyst
Chloro[(S)-2,2'-bis(bis(3,5-dimethylphenyl)phosphino)-1,1'-binaphthyl](p-cymene)ruthenium(II) chloride
asymmetric hydrogenation catalyst
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
(S)-(+)-1-[(R)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDIPHENYLPHOSPHINE
chiral phosphine ligand for asymmetric catalysis
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane
IOPQYDKQISFMJI-UHFFFAOYSA-N
CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C
2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.