Isophthaloyl chloride is a chemical compound primarily used as an intermediate in the production of dyes and synthetic fibers. It features a benzene ring with two acid chloride functional groups, making it reactive in polymer and dye synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 99-63-8
3-Chlorobenzoyl chloride
Pharmaceutical intermediate
1,3-Dinitrobenzene
intermediate for dyes and explosives
Irganox 565
Antioxidant stabilizing agent
1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane
Fluorinated solvent or intermediate
(3-methyloxetan-3-yl)methyl 4-methylbenzenesulfonate
benzenesulfonate ester intermediate
benzene-1,3-dicarbonyl chloride
FDQSRULYDNDXQB-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl