4-Bromobenzenesulfonyl chloride is a chemical compound commonly employed as a reagent in organic synthesis. It features an aromatic ring substituted with both a bromine atom and a sulfonyl chloride group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 98-58-8
2-Ethylhexyl chloroformate
Reagent for organic synthesis
4-Methoxybenzenesulfonyl chloride
Sulfonyl chloride reagent for synthesis
4-tert-Butylbenzoic acid
alkyd resin modifier and corrosion inhibitor
Piperidinium piperidine-1-carbodithioate
rubber accelerator
CUMENE
Production of phenol and acetone
4-bromobenzenesulfonyl chloride
KMMHZIBWCXYAAH-UHFFFAOYSA-N
C1=CC(=CC=C1S(=O)(=O)Cl)Br