4-Bromobenzenesulfonyl chloride is a chemical compound commonly employed as a reagent in organic synthesis. It features an aromatic ring substituted with both a bromine atom and a sulfonyl chloride group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Bromobenzenesulfonyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Ethylhexyl chloroformate
Reagent for organic synthesis
4-Methoxybenzenesulfonyl chloride
Sulfonyl chloride reagent for synthesis
4-tert-Butylbenzoic acid
alkyd resin modifier and corrosion inhibitor
Piperidinium piperidine-1-carbodithioate
rubber accelerator
CUMENE
Production of phenol and acetone
4-Bromobenzenesulfonyl chloride(CAS 98-58-8)의 국제 HS 코드는 2904.99입니다.
2904.99
2904 99 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
4-bromobenzenesulfonyl chloride
KMMHZIBWCXYAAH-UHFFFAOYSA-N
C1=CC(=CC=C1S(=O)(=O)Cl)Br
4-Bromobenzenesulfonyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.