S-adenosylhomocysteine is an organic sulfide that serves as the S-adenosyl derivative of L-homocysteine. It functions as a cofactor and a fundamental metabolite in biochemical processes, and is known to inhibit certain methyltransferases and synthases.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 979-92-0
4-Hydroxyisoleucine
Biochemical research reagent
Sulfuric acid--7H-purin-6-amine--water (1/2/2)
Biochemical research reagent
D-Glucopyranuronic acid
Biochemical research reagent
N-Acetyl-D-mannosamine hydrate
Biochemical research reagent
2-Thiophenecarboxaldehyde
organic synthesis building block
4-Iodobenzenesulfonyl chloride
research reagent for sulfonylation
4-Nitrobenzenesulfonyl chloride
Detection and characterization reagent
3-Oxocyclopentanecarboxylic acid
research compound
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid
ZJUKTBDSGOFHSH-WFMPWKQPSA-N
C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CSCC[C@@H](C(=O)O)N)O)O)N