2,5-Hexanedione-d10 is a deuterated research compound used primarily in laboratory and scientific investigations. Its isotopically labeled structure makes it valuable for studies involving metabolic tracing or analytical method development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,5-HEXANEDIONE-D10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Pentanone-1,1,1,3,3-d5
Deuterated research reference standard
Benzyl (2R)-hydroxy(phenyl)acetate
Research compound
Sodium ionophore X
ionophore for sodium ion sensing
2-((2-benzylidene-1-isopropylhydrazinyl)methylene)malononitrile
research compound
N-benzyl-6-(4-phenylbutoxy)hexan-1-amine
Research compound
2,5-HEXANEDIONE
solvent for coatings and intermediate
1,1,1,3,3,4,4,6,6,6-decadeuteriohexane-2,5-dione
OJVAMHKKJGICOG-MWUKXHIBSA-N
[2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])C(=O)C([2H])([2H])[2H]
2,5-HEXANEDIONE-D10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.