3-Nitrophthalamide is a chemical compound featuring a benzene ring substituted with two amide groups and a nitro group. It serves as a research chemical intermediate in laboratory and industrial settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Nitrophthalamide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-bromo-5-chloroaniline
research compound
4-Nitrophenyl 4,6-ethylidene-a-D-maltoheptaoside
chromogenic substrate for enzyme assays
3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid
research compound
3-Methoxy-4-hydroxyphenylethylamine hydrochloride
research compound
3-nitrobenzene-1,2-dicarboxamide
GMOAOEGBMSRFFQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)C(=O)N
3-Nitrophthalamide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.