Calix[6]arene is a macrocyclic compound composed of six phenolic units linked by methylene bridges, forming a bowl-shaped structure. It is widely used as a host molecule in supramolecular chemistry for molecular recognition and encapsulation studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Calix[6]arene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-(trans-4-Vinylcyclohexyl)benzonitrile
liquid crystalline intermediate
2-(2'-hydroxy-5'-methacryloxyethylphenyl)-2h-benzotriazole
UV absorber intermediate
1,4,7-Trimethyl-1,4,7-triazacyclononane
Tridentate ligand for coordination chemistry
(trans,trans)-4-Butyl-4'-propyl-1,1'-bicyclohexyl
liquid crystal intermediate
heptacyclo[31.3.1.13,7.19,13.115,19.121,25.127,31]dotetraconta-1(37),3(42),4,6,9(41),10,12,15(40),16,18,21,23,25(39),27,29,31(38),33,35-octadecaene-37,38,39,40,41,42-hexol
JLSWUKWFQCVKCL-UHFFFAOYSA-N
C1C2=C(C(=CC=C2)CC3=C(C(=CC=C3)CC4=C(C(=CC=C4)CC5=CC=CC(=C5O)CC6=CC=CC(=C6O)CC7=CC=CC1=C7O)O)O)O
Calix[6]arene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.