2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride is a research compound featuring a dichlorophenyl ring and a fluorine-substituted ethanamine group. Its structure includes an amine functional group and multiple halogens, and it is supplied as a hydrochloride salt for laboratory use.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(4-Aminophenyl)boronic acid hydrate
Research reagent for boronic acid chemistry
Propan-2-yl prop-2-ynoate
research compound
2'-deoxyguanosine
research compound for oxidative stress studies
2,4,6-Tri-tert-butylaniline
research compound
2-(2,4-dichlorophenyl)-2-fluoroethanamine;hydrochloride
PBEKPQSMDQIZFJ-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)Cl)C(CN)F.Cl
—
2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.