1-Amino Hydantoin-13C3 is a carbon-13 isotopically labeled derivative of 1-amino hydantoin, used primarily as an analytical standard in research and laboratory settings. Its isotopic labeling facilitates precise quantification and tracing in mass spectrometry and related analytical applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 957509-31-8
2-NP-SCA 13C,15N2
isotopically labeled research compound
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-nitro-L-phenylalanine
Peptide synthesis intermediate
Fmoc-Ile-Thr(Psi(Me,Me)pro)-OH
research reagent for peptide synthesis
Fmoc-Glu(OtBu)-Thr(psi(Me,Me)pro)-OH
synthetic peptide building block
1-Aminohydantoin hydrochloride
research compound for chemical synthesis
1-amino-(2,4,5-13C3)1,3-diazolidine-2,4-dione
KVYKDNGUEZRPGJ-VMIGTVKRSA-N
[13CH2]1[13C](=O)N[13C](=O)N1N